C15H19Cl2NO4 — CID 46613000
2,2-dichloro-1-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]cyclopropane-1-carboxamide (PubChem CID 46613000) has the molecular formula C15H19Cl2NO4 and a molecular weight of 348.23 g/mol. Its IUPAC name is 2,2-dichloro-1-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-1-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 46613000 |
| Molecular Formula | C15H19Cl2NO4 |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 2,2-dichloro-1-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]cyclopropane-1-carboxamide |
| SMILES | COc1cc(CNC(=O)C2(C)CC2(Cl)Cl)cc(OC)c1OC |
| InChI | InChI=1S/C15H19Cl2NO4/c1-14(8-15(14,16)17)13(19)18-7-9-5-10(20-2)12(22-4)11(6-9)21-3/h5-6H,7-8H2,1-4H3,(H,18,19) |
| InChIKey | KENVSXAZAFIZMX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|