C19H19N3O4 — CID 119944182
[4-(2-aminobenzoyl)piperazin-1-yl]-(1,3-benzodioxol-5-yl)methanone (PubChem CID 119944182) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is [4-(2-aminobenzoyl)piperazin-1-yl]-(1,3-benzodioxol-5-yl)methanone.
| Compound Name | [4-(2-aminobenzoyl)piperazin-1-yl]-(1,3-benzodioxol-5-yl)methanone |
|---|---|
| PubChem CID | 119944182 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | [4-(2-aminobenzoyl)piperazin-1-yl]-(1,3-benzodioxol-5-yl)methanone |
| SMILES | Nc1ccccc1C(=O)N1CCN(C(=O)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C19H19N3O4/c20-15-4-2-1-3-14(15)19(24)22-9-7-21(8-10-22)18(23)13-5-6-16-17(11-13)26-12-25-16/h1-6,11H,7-10,12,20H2 |
| InChIKey | XDFITSBIRRTXOC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|