C15H22N2O — CID 119945566
2-amino-N-hept-6-enyl-N-methylbenzamide (PubChem CID 119945566) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-amino-N-hept-6-enyl-N-methylbenzamide.
| Compound Name | 2-amino-N-hept-6-enyl-N-methylbenzamide |
|---|---|
| PubChem CID | 119945566 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 2-amino-N-hept-6-enyl-N-methylbenzamide |
| SMILES | C=CCCCCCN(C)C(=O)c1ccccc1N |
| InChI | InChI=1S/C15H22N2O/c1-3-4-5-6-9-12-17(2)15(18)13-10-7-8-11-14(13)16/h3,7-8,10-11H,1,4-6,9,12,16H2,2H3 |
| InChIKey | MNHCAGVNMSIDTB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|