C17H26Cl2FN3O — CID 119946055
[4-(2-fluorophenyl)piperazin-1-yl]-(3-methylpiperidin-3-yl)methanone;dihydrochloride (PubChem CID 119946055) has the molecular formula C17H26Cl2FN3O and a molecular weight of 378.32 g/mol. Its IUPAC name is [4-(2-fluorophenyl)piperazin-1-yl]-(3-methylpiperidin-3-yl)methanone;dihydrochloride.
| Compound Name | [4-(2-fluorophenyl)piperazin-1-yl]-(3-methylpiperidin-3-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119946055 |
| Molecular Formula | C17H26Cl2FN3O |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | [4-(2-fluorophenyl)piperazin-1-yl]-(3-methylpiperidin-3-yl)methanone;dihydrochloride |
| SMILES | CC1(C(=O)N2CCN(c3ccccc3F)CC2)CCCNC1.Cl.Cl |
| InChI | InChI=1S/C17H24FN3O.2ClH/c1-17(7-4-8-19-13-17)16(22)21-11-9-20(10-12-21)15-6-3-2-5-14(15)18;;/h2-3,5-6,19H,4,7-13H2,1H3;2*1H |
| InChIKey | DGDREGRLWZZOSS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |