C19H31Cl2N3O — CID 119946069
N-(1-benzylpiperidin-4-yl)-3-methylpiperidine-3-carboxamide;dihydrochloride (PubChem CID 119946069) has the molecular formula C19H31Cl2N3O and a molecular weight of 388.38 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-3-methylpiperidine-3-carboxamide;dihydrochloride.
| Compound Name | N-(1-benzylpiperidin-4-yl)-3-methylpiperidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119946069 |
| Molecular Formula | C19H31Cl2N3O |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-3-methylpiperidine-3-carboxamide;dihydrochloride |
| SMILES | CC1(C(=O)NC2CCN(Cc3ccccc3)CC2)CCCNC1.Cl.Cl |
| InChI | InChI=1S/C19H29N3O.2ClH/c1-19(10-5-11-20-15-19)18(23)21-17-8-12-22(13-9-17)14-16-6-3-2-4-7-16;;/h2-4,6-7,17,20H,5,8-15H2,1H3,(H,21,23);2*1H |
| InChIKey | IIIXDDKOOJDCAX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |