C14H23Cl2N3O — CID 119946078
3-methyl-N-(2-pyridin-2-ylethyl)piperidine-3-carboxamide;dihydrochloride (PubChem CID 119946078) has the molecular formula C14H23Cl2N3O and a molecular weight of 320.26 g/mol. Its IUPAC name is 3-methyl-N-(2-pyridin-2-ylethyl)piperidine-3-carboxamide;dihydrochloride.
| Compound Name | 3-methyl-N-(2-pyridin-2-ylethyl)piperidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119946078 |
| Molecular Formula | C14H23Cl2N3O |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 3-methyl-N-(2-pyridin-2-ylethyl)piperidine-3-carboxamide;dihydrochloride |
| SMILES | CC1(C(=O)NCCc2ccccn2)CCCNC1.Cl.Cl |
| InChI | InChI=1S/C14H21N3O.2ClH/c1-14(7-4-8-15-11-14)13(18)17-10-6-12-5-2-3-9-16-12;;/h2-3,5,9,15H,4,6-8,10-11H2,1H3,(H,17,18);2*1H |
| InChIKey | VXYUJCWDPPHURU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |