C15H23Cl2N3O2 — CID 155834162
(3aR,7aR)-N-(2-pyridin-2-ylethyl)-3,4,5,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine-3a-carboxamide;dihydrochloride (PubChem CID 155834162) has the molecular formula C15H23Cl2N3O2 and a molecular weight of 348.27 g/mol. Its IUPAC name is (3aR,7aR)-N-(2-pyridin-2-ylethyl)-3,4,5,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine-3a-carboxamide;dihydrochloride.
| Compound Name | (3aR,7aR)-N-(2-pyridin-2-ylethyl)-3,4,5,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine-3a-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 155834162 |
| Molecular Formula | C15H23Cl2N3O2 |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (3aR,7aR)-N-(2-pyridin-2-ylethyl)-3,4,5,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine-3a-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCc1ccccn1)[C@@]12CCO[C@@H]1CCNC2 |
| InChI | InChI=1S/C15H21N3O2.2ClH/c19-14(18-9-4-12-3-1-2-7-17-12)15-6-10-20-13(15)5-8-16-11-15;;/h1-3,7,13,16H,4-6,8-11H2,(H,18,19);2*1H/t13-,15-;;/m1../s1 |
| InChIKey | KCFXJABLQXMZDL-FVAFFMJJSA-N |
| XLogP | 1.35 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |