C18H25Cl2N3OS — CID 119947232
2-amino-N-[2-(4-cyclohexyl-1,3-thiazol-2-yl)ethyl]benzamide;dihydrochloride (PubChem CID 119947232) has the molecular formula C18H25Cl2N3OS and a molecular weight of 402.39 g/mol. Its IUPAC name is 2-amino-N-[2-(4-cyclohexyl-1,3-thiazol-2-yl)ethyl]benzamide;dihydrochloride.
| Compound Name | 2-amino-N-[2-(4-cyclohexyl-1,3-thiazol-2-yl)ethyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119947232 |
| Molecular Formula | C18H25Cl2N3OS |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 2-amino-N-[2-(4-cyclohexyl-1,3-thiazol-2-yl)ethyl]benzamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccccc1C(=O)NCCc1nc(C2CCCCC2)cs1 |
| InChI | InChI=1S/C18H23N3OS.2ClH/c19-15-9-5-4-8-14(15)18(22)20-11-10-17-21-16(12-23-17)13-6-2-1-3-7-13;;/h4-5,8-9,12-13H,1-3,6-7,10-11,19H2,(H,20,22);2*1H |
| InChIKey | ZOAZXUKGIUETRK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|