C13H18ClN3O3 — CID 119947767
2-methoxy-N-[[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]ethanamine;hydrochloride (PubChem CID 119947767) has the molecular formula C13H18ClN3O3 and a molecular weight of 299.76 g/mol. Its IUPAC name is 2-methoxy-N-[[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]ethanamine;hydrochloride.
| Compound Name | 2-methoxy-N-[[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 119947767 |
| Molecular Formula | C13H18ClN3O3 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 2-methoxy-N-[[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]ethanamine;hydrochloride |
| SMILES | COCCNCc1nc(-c2ccccc2OC)no1.Cl |
| InChI | InChI=1S/C13H17N3O3.ClH/c1-17-8-7-14-9-12-15-13(16-19-12)10-5-3-4-6-11(10)18-2;/h3-6,14H,7-9H2,1-2H3;1H |
| InChIKey | ZKNFSNNJUZDWQA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|