C9H14ClN5O2 — CID 137076816
N-[[3-(1H-imidazol-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-2-methoxyethanamine;hydrochloride (PubChem CID 137076816) has the molecular formula C9H14ClN5O2 and a molecular weight of 259.70 g/mol. Its IUPAC name is N-[[3-(1H-imidazol-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-2-methoxyethanamine;hydrochloride.
| Compound Name | N-[[3-(1H-imidazol-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-2-methoxyethanamine;hydrochloride |
|---|---|
| PubChem CID | 137076816 |
| Molecular Formula | C9H14ClN5O2 |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-[[3-(1H-imidazol-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-2-methoxyethanamine;hydrochloride |
| SMILES | COCCNCc1nc(-c2ncc[nH]2)no1.Cl |
| InChI | InChI=1S/C9H13N5O2.ClH/c1-15-5-4-10-6-7-13-9(14-16-7)8-11-2-3-12-8;/h2-3,10H,4-6H2,1H3,(H,11,12);1H |
| InChIKey | VYBITBVMLAFQAW-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|