C11H12Cl2N4O2 — CID 79786407
N-[[3-(3,5-dichloro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methoxyethanamine (PubChem CID 79786407) has the molecular formula C11H12Cl2N4O2 and a molecular weight of 303.15 g/mol. Its IUPAC name is N-[[3-(3,5-dichloro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[3-(3,5-dichloro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 79786407 |
| Molecular Formula | C11H12Cl2N4O2 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | N-[[3-(3,5-dichloro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1nc(-c2ncc(Cl)cc2Cl)no1 |
| InChI | InChI=1S/C11H12Cl2N4O2/c1-18-3-2-14-6-9-16-11(17-19-9)10-8(13)4-7(12)5-15-10/h4-5,14H,2-3,6H2,1H3 |
| InChIKey | LCLOPQVIIXDCJV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|