C27H31N3O7S — CID 11994837
diethyl (1R,7R)-3-amino-2-cyano-1-[(2S)-1,3-dioxo-1-propan-2-yloxybutan-2-yl]-5-methyl-7-thiophen-2-yl-1,7-dihydroindolizine-6,8-dicarboxylate (PubChem CID 11994837) has the molecular formula C27H31N3O7S and a molecular weight of 541.63 g/mol. Its IUPAC name is diethyl (1R,7R)-3-amino-2-cyano-1-[(2S)-1,3-dioxo-1-propan-2-yloxybutan-2-yl]-5-methyl-7-thiophen-2-yl-1,7-dihydroindolizine-6,8-dicarboxylate.
| Compound Name | diethyl (1R,7R)-3-amino-2-cyano-1-[(2S)-1,3-dioxo-1-propan-2-yloxybutan-2-yl]-5-methyl-7-thiophen-2-yl-1,7-dihydroindolizine-6,8-dicarboxylate |
|---|---|
| PubChem CID | 11994837 |
| Molecular Formula | C27H31N3O7S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | diethyl (1R,7R)-3-amino-2-cyano-1-[(2S)-1,3-dioxo-1-propan-2-yloxybutan-2-yl]-5-methyl-7-thiophen-2-yl-1,7-dihydroindolizine-6,8-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N2C(N)=C(C#N)[C@@H]([C@@H](C(C)=O)C(=O)OC(C)C)C2=C(C(=O)OCC)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C27H31N3O7S/c1-7-35-25(32)18-14(5)30-23(22(26(33)36-8-2)21(18)17-10-9-11-38-17)20(16(12-28)24(30)29)19(15(6)31)27(34)37-13(3)4/h9-11,13,19-21H,7-8,29H2,1-6H3/t19-,20+,21-/m1/s1 |
| InChIKey | VOOXDRYJRHODIF-QHAWAJNXSA-N |
| XLogP | 3.28 |
| TPSA | 149.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|