C26H29N3O7S — CID 54690607
diethyl (7S,8S)-3-amino-2-cyano-1-[(Z)-1-ethoxy-3-hydroxy-1-oxobut-2-en-2-yl]-5-methyl-7-thiophen-2-yl-7,8-dihydroindolizine-6,8-dicarboxylate (PubChem CID 54690607) has the molecular formula C26H29N3O7S and a molecular weight of 527.60 g/mol. Its IUPAC name is diethyl (7S,8S)-3-amino-2-cyano-1-[(Z)-1-ethoxy-3-hydroxy-1-oxobut-2-en-2-yl]-5-methyl-7-thiophen-2-yl-7,8-dihydroindolizine-6,8-dicarboxylate.
| Compound Name | diethyl (7S,8S)-3-amino-2-cyano-1-[(Z)-1-ethoxy-3-hydroxy-1-oxobut-2-en-2-yl]-5-methyl-7-thiophen-2-yl-7,8-dihydroindolizine-6,8-dicarboxylate |
|---|---|
| PubChem CID | 54690607 |
| Molecular Formula | C26H29N3O7S |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | diethyl (7S,8S)-3-amino-2-cyano-1-[(Z)-1-ethoxy-3-hydroxy-1-oxobut-2-en-2-yl]-5-methyl-7-thiophen-2-yl-7,8-dihydroindolizine-6,8-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)n2c(N)c(C#N)c(/C(C(=O)OCC)=C(\C)O)c2[C@@H](C(=O)OCC)[C@@H]1c1cccs1 |
| InChI | InChI=1S/C26H29N3O7S/c1-6-34-24(31)17-13(4)29-22(21(26(33)36-8-3)20(17)16-10-9-11-37-16)19(15(12-27)23(29)28)18(14(5)30)25(32)35-7-2/h9-11,20-21,30H,6-8,28H2,1-5H3/b18-14-/t20-,21+/m1/s1 |
| InChIKey | PYBDSHAGLFLNKC-HPBQKALYSA-N |
| XLogP | 4.09 |
| TPSA | 153.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|