C23H29N3O2 — CID 119950296
N-[3-[[(3-amino-3-phenylpropanoyl)amino]methyl]phenyl]cyclohexanecarboxamide (PubChem CID 119950296) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is N-[3-[[(3-amino-3-phenylpropanoyl)amino]methyl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[[(3-amino-3-phenylpropanoyl)amino]methyl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 119950296 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | N-[3-[[(3-amino-3-phenylpropanoyl)amino]methyl]phenyl]cyclohexanecarboxamide |
| SMILES | NC(CC(=O)NCc1cccc(NC(=O)C2CCCCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C23H29N3O2/c24-21(18-9-3-1-4-10-18)15-22(27)25-16-17-8-7-13-20(14-17)26-23(28)19-11-5-2-6-12-19/h1,3-4,7-10,13-14,19,21H,2,5-6,11-12,15-16,24H2,(H,25,27)(H,26,28) |
| InChIKey | GCGVOLORUMRBCV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |