C16H27ClN2OS — CID 119952430
3-amino-N-(4-ethylsulfanylbutan-2-yl)-N-methyl-3-phenylpropanamide;hydrochloride (PubChem CID 119952430) has the molecular formula C16H27ClN2OS and a molecular weight of 330.93 g/mol. Its IUPAC name is 3-amino-N-(4-ethylsulfanylbutan-2-yl)-N-methyl-3-phenylpropanamide;hydrochloride.
| Compound Name | 3-amino-N-(4-ethylsulfanylbutan-2-yl)-N-methyl-3-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119952430 |
| Molecular Formula | C16H27ClN2OS |
| Molecular Weight | 330.93 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 3-amino-N-(4-ethylsulfanylbutan-2-yl)-N-methyl-3-phenylpropanamide;hydrochloride |
| SMILES | CCSCCC(C)N(C)C(=O)CC(N)c1ccccc1.Cl |
| InChI | InChI=1S/C16H26N2OS.ClH/c1-4-20-11-10-13(2)18(3)16(19)12-15(17)14-8-6-5-7-9-14;/h5-9,13,15H,4,10-12,17H2,1-3H3;1H |
| InChIKey | XFYUAKHWBPFMTK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.93 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|