C13H19NO5 — CID 119954509
2-[butan-2-yl-[5-(methoxymethyl)furan-2-carbonyl]amino]acetic acid (PubChem CID 119954509) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-[butan-2-yl-[5-(methoxymethyl)furan-2-carbonyl]amino]acetic acid.
| Compound Name | 2-[butan-2-yl-[5-(methoxymethyl)furan-2-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 119954509 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-[butan-2-yl-[5-(methoxymethyl)furan-2-carbonyl]amino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)C(=O)c1ccc(COC)o1 |
| InChI | InChI=1S/C13H19NO5/c1-4-9(2)14(7-12(15)16)13(17)11-6-5-10(19-11)8-18-3/h5-6,9H,4,7-8H2,1-3H3,(H,15,16) |
| InChIKey | NHKWZQOOYISTGN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |