C10H20N2O5S — CID 119954604
2-[butan-2-yl-[2-[methyl(methylsulfonyl)amino]acetyl]amino]acetic acid (PubChem CID 119954604) has the molecular formula C10H20N2O5S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-[butan-2-yl-[2-[methyl(methylsulfonyl)amino]acetyl]amino]acetic acid.
| Compound Name | 2-[butan-2-yl-[2-[methyl(methylsulfonyl)amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 119954604 |
| Molecular Formula | C10H20N2O5S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-[butan-2-yl-[2-[methyl(methylsulfonyl)amino]acetyl]amino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)C(=O)CN(C)S(C)(=O)=O |
| InChI | InChI=1S/C10H20N2O5S/c1-5-8(2)12(7-10(14)15)9(13)6-11(3)18(4,16)17/h8H,5-7H2,1-4H3,(H,14,15) |
| InChIKey | YHQVYCBCKMZSEP-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |