C17H25FN2O5S — CID 119954928
2-[butan-2-yl-[4-[(4-fluorophenyl)sulfonyl-methylamino]butanoyl]amino]acetic acid (PubChem CID 119954928) has the molecular formula C17H25FN2O5S and a molecular weight of 388.46 g/mol. Its IUPAC name is 2-[butan-2-yl-[4-[(4-fluorophenyl)sulfonyl-methylamino]butanoyl]amino]acetic acid.
| Compound Name | 2-[butan-2-yl-[4-[(4-fluorophenyl)sulfonyl-methylamino]butanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 119954928 |
| Molecular Formula | C17H25FN2O5S |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-[butan-2-yl-[4-[(4-fluorophenyl)sulfonyl-methylamino]butanoyl]amino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)C(=O)CCCN(C)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H25FN2O5S/c1-4-13(2)20(12-17(22)23)16(21)6-5-11-19(3)26(24,25)15-9-7-14(18)8-10-15/h7-10,13H,4-6,11-12H2,1-3H3,(H,22,23) |
| InChIKey | KGHPFNZLTBPRHV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |