C17H27FN2O3S — CID 55602011
2-[(4-fluorophenyl)sulfonyl-methylamino]-N-pentyl-N-propan-2-ylacetamide (PubChem CID 55602011) has the molecular formula C17H27FN2O3S and a molecular weight of 358.48 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)sulfonyl-methylamino]-N-pentyl-N-propan-2-ylacetamide.
| Compound Name | 2-[(4-fluorophenyl)sulfonyl-methylamino]-N-pentyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 55602011 |
| Molecular Formula | C17H27FN2O3S |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 2-[(4-fluorophenyl)sulfonyl-methylamino]-N-pentyl-N-propan-2-ylacetamide |
| SMILES | CCCCCN(C(=O)CN(C)S(=O)(=O)c1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C17H27FN2O3S/c1-5-6-7-12-20(14(2)3)17(21)13-19(4)24(22,23)16-10-8-15(18)9-11-16/h8-11,14H,5-7,12-13H2,1-4H3 |
| InChIKey | BBJPRGMCFKSWMD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|