C12H21N2O15P3 — CID 11995643
[[(2R,3S,4R,5R)-5-(2,4-dioxo-6-propyl-1H-pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 11995643) has the molecular formula C12H21N2O15P3 and a molecular weight of 526.22 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(2,4-dioxo-6-propyl-1H-pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(2,4-dioxo-6-propyl-1H-pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 11995643 |
| Molecular Formula | C12H21N2O15P3 |
| Molecular Weight | 526.22 g/mol |
| Exact Mass | 526.02 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(2,4-dioxo-6-propyl-1H-pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CCCc1cc(=O)n([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C12H21N2O15P3/c1-2-3-6-4-8(15)14(12(18)13-6)11-10(17)9(16)7(27-11)5-26-31(22,23)29-32(24,25)28-30(19,20)21/h4,7,9-11,16-17H,2-3,5H2,1H3,(H,13,18)(H,22,23)(H,24,25)(H2,19,20,21)/t7-,9-,10-,11-/m1/s1 |
| InChIKey | NHAYKDHIHBRAHL-QCNRFFRDSA-N |
| XLogP | -1.55 |
| TPSA | 264.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.22 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|