C15H24Cl2N2O4S — CID 119957708
2-amino-N-[2-(2-chlorophenoxy)butyl]-4-methylsulfonylbutanamide;hydrochloride (PubChem CID 119957708) has the molecular formula C15H24Cl2N2O4S and a molecular weight of 399.34 g/mol. Its IUPAC name is 2-amino-N-[2-(2-chlorophenoxy)butyl]-4-methylsulfonylbutanamide;hydrochloride.
| Compound Name | 2-amino-N-[2-(2-chlorophenoxy)butyl]-4-methylsulfonylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119957708 |
| Molecular Formula | C15H24Cl2N2O4S |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 2-amino-N-[2-(2-chlorophenoxy)butyl]-4-methylsulfonylbutanamide;hydrochloride |
| SMILES | CCC(CNC(=O)C(N)CCS(C)(=O)=O)Oc1ccccc1Cl.Cl |
| InChI | InChI=1S/C15H23ClN2O4S.ClH/c1-3-11(22-14-7-5-4-6-12(14)16)10-18-15(19)13(17)8-9-23(2,20)21;/h4-7,11,13H,3,8-10,17H2,1-2H3,(H,18,19);1H |
| InChIKey | SMXHQJDGAXHFKD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |