C20H26Cl2N4O — CID 119957910
(2S)-2-amino-3-(1H-indol-3-yl)-N-[2-(N-methylanilino)ethyl]propanamide;dihydrochloride (PubChem CID 119957910) has the molecular formula C20H26Cl2N4O and a molecular weight of 409.36 g/mol. Its IUPAC name is (2S)-2-amino-3-(1H-indol-3-yl)-N-[2-(N-methylanilino)ethyl]propanamide;dihydrochloride.
| Compound Name | (2S)-2-amino-3-(1H-indol-3-yl)-N-[2-(N-methylanilino)ethyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119957910 |
| Molecular Formula | C20H26Cl2N4O |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | (2S)-2-amino-3-(1H-indol-3-yl)-N-[2-(N-methylanilino)ethyl]propanamide;dihydrochloride |
| SMILES | CN(CCNC(=O)[C@@H](N)Cc1c[nH]c2ccccc12)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C20H24N4O.2ClH/c1-24(16-7-3-2-4-8-16)12-11-22-20(25)18(21)13-15-14-23-19-10-6-5-9-17(15)19;;/h2-10,14,18,23H,11-13,21H2,1H3,(H,22,25);2*1H/t18-;;/m0../s1 |
| InChIKey | CYSKEWHVEQKRIK-NTEVMMBTSA-N |
| XLogP | 3.13 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |