C13H20ClN3O4S — CID 119959880
1-(2,3-dimethyl-6-nitrophenyl)sulfonylpiperidin-3-amine;hydrochloride (PubChem CID 119959880) has the molecular formula C13H20ClN3O4S and a molecular weight of 349.84 g/mol. Its IUPAC name is 1-(2,3-dimethyl-6-nitrophenyl)sulfonylpiperidin-3-amine;hydrochloride.
| Compound Name | 1-(2,3-dimethyl-6-nitrophenyl)sulfonylpiperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119959880 |
| Molecular Formula | C13H20ClN3O4S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 1-(2,3-dimethyl-6-nitrophenyl)sulfonylpiperidin-3-amine;hydrochloride |
| SMILES | Cc1ccc([N+](=O)[O-])c(S(=O)(=O)N2CCCC(N)C2)c1C.Cl |
| InChI | InChI=1S/C13H19N3O4S.ClH/c1-9-5-6-12(16(17)18)13(10(9)2)21(19,20)15-7-3-4-11(14)8-15;/h5-6,11H,3-4,7-8,14H2,1-2H3;1H |
| InChIKey | AHQXGPOVNKMVRY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|