C14H21N3O4S — CID 119963986
[1-(2,3-dimethyl-6-nitrophenyl)sulfonylpiperidin-4-yl]methanamine (PubChem CID 119963986) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is [1-(2,3-dimethyl-6-nitrophenyl)sulfonylpiperidin-4-yl]methanamine.
| Compound Name | [1-(2,3-dimethyl-6-nitrophenyl)sulfonylpiperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 119963986 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | [1-(2,3-dimethyl-6-nitrophenyl)sulfonylpiperidin-4-yl]methanamine |
| SMILES | Cc1ccc([N+](=O)[O-])c(S(=O)(=O)N2CCC(CN)CC2)c1C |
| InChI | InChI=1S/C14H21N3O4S/c1-10-3-4-13(17(18)19)14(11(10)2)22(20,21)16-7-5-12(9-15)6-8-16/h3-4,12H,5-9,15H2,1-2H3 |
| InChIKey | KKAYWCWJDYPEMW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|