C13H16N2O5S — CID 63845195
1-(2-methyl-6-nitrophenyl)sulfonylpiperidine-4-carbaldehyde (PubChem CID 63845195) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is 1-(2-methyl-6-nitrophenyl)sulfonylpiperidine-4-carbaldehyde.
| Compound Name | 1-(2-methyl-6-nitrophenyl)sulfonylpiperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 63845195 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 1-(2-methyl-6-nitrophenyl)sulfonylpiperidine-4-carbaldehyde |
| SMILES | Cc1cccc([N+](=O)[O-])c1S(=O)(=O)N1CCC(C=O)CC1 |
| InChI | InChI=1S/C13H16N2O5S/c1-10-3-2-4-12(15(17)18)13(10)21(19,20)14-7-5-11(9-16)6-8-14/h2-4,9,11H,5-8H2,1H3 |
| InChIKey | JSDUYYHVFMVWKM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|