C16H17N3O7S — CID 155962571
5-[1-(2-methyl-6-nitrophenyl)sulfonylpiperidin-4-yl]-1,3-oxazole-4-carboxylic acid (PubChem CID 155962571) has the molecular formula C16H17N3O7S and a molecular weight of 395.39 g/mol. Its IUPAC name is 5-[1-(2-methyl-6-nitrophenyl)sulfonylpiperidin-4-yl]-1,3-oxazole-4-carboxylic acid.
| Compound Name | 5-[1-(2-methyl-6-nitrophenyl)sulfonylpiperidin-4-yl]-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 155962571 |
| Molecular Formula | C16H17N3O7S |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 5-[1-(2-methyl-6-nitrophenyl)sulfonylpiperidin-4-yl]-1,3-oxazole-4-carboxylic acid |
| SMILES | Cc1cccc([N+](=O)[O-])c1S(=O)(=O)N1CCC(c2ocnc2C(=O)O)CC1 |
| InChI | InChI=1S/C16H17N3O7S/c1-10-3-2-4-12(19(22)23)15(10)27(24,25)18-7-5-11(6-8-18)14-13(16(20)21)17-9-26-14/h2-4,9,11H,5-8H2,1H3,(H,20,21) |
| InChIKey | CBSNUBGFTLRCGS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 143.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|