About N-[4-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]morpholine-4-carboxamide
N-[4-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]morpholine-4-carboxamide (PubChem CID 11996107) has the molecular formula C16H17N7O2
and a molecular weight of 339.36 g/mol. Its IUPAC name is N-[4-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]morpholine-4-carboxamide.
Molecular Properties
| Compound Name | N-[4-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]morpholine-4-carboxamide |
| PubChem CID | 11996107 |
| Molecular Formula | C16H17N7O2 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | N-[4-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]morpholine-4-carboxamide |
| SMILES | Nc1ncnc2c1cnn2-c1ccc(NC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C16H17N7O2/c17-14-13-9-20-23(15(13)19-10-18-14)12-3-1-11(2-4-12)21-16(24)22-5-7-25-8-6-22/h1-4,9-10H,5-8H2,(H,21,24)(H2,17,18,19) |
| InChIKey | DFZHRTHBOOMGSC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[4-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]morpholine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]morpholine-4-carboxamide?
The IUPAC name of N-[4-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]morpholine-4-carboxamide (CID 11996107) is N-[4-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]morpholine-4-carboxamide.
What is the SMILES notation for N-[4-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]morpholine-4-carboxamide?
The canonical SMILES for N-[4-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]morpholine-4-carboxamide is Nc1ncnc2c1cnn2-c1ccc(NC(=O)N2CCOCC2)cc1.
What is the InChIKey of N-[4-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]morpholine-4-carboxamide?
The InChIKey is DFZHRTHBOOMGSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N7O2/c17-14-13-9-20-23(15(13)19-10-18-14)12-3-1-11(2-4-12)21-16(24)22-5-7-25-8-6-22/h1-4,9-10H,5-8H2,(H,21,24)(H2,17,18,19).
What are the key properties of N-[4-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]morpholine-4-carboxamide?
N-[4-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]morpholine-4-carboxamide has a molecular weight of 339.36 g/mol, XLogP of 1.26, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(4-aminopyrazolo[3,4-d]pyrimidin-1-yl)phenyl]morpholine-4-carboxamide is sourced from PubChem (CID 11996107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).