C38H43N5O5 — CID 11996146
[1-[2-[[3-[2-[(2-hydroxyphenyl)methylamino]ethylcarbamoyl]benzoyl]-methylamino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 11996146) has the molecular formula C38H43N5O5 and a molecular weight of 649.79 g/mol. Its IUPAC name is [1-[2-[[3-[2-[(2-hydroxyphenyl)methylamino]ethylcarbamoyl]benzoyl]-methylamino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[2-[[3-[2-[(2-hydroxyphenyl)methylamino]ethylcarbamoyl]benzoyl]-methylamino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 11996146 |
| Molecular Formula | C38H43N5O5 |
| Molecular Weight | 649.79 g/mol |
| Exact Mass | 649.33 |
| IUPAC Name | [1-[2-[[3-[2-[(2-hydroxyphenyl)methylamino]ethylcarbamoyl]benzoyl]-methylamino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | CN(CCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1)C(=O)c1cccc(C(=O)NCCNCc2ccccc2O)c1 |
| InChI | InChI=1S/C38H43N5O5/c1-42(37(46)30-14-9-13-29(26-30)36(45)40-21-20-39-27-31-12-5-8-17-35(31)44)24-25-43-22-18-32(19-23-43)48-38(47)41-34-16-7-6-15-33(34)28-10-3-2-4-11-28/h2-17,26,32,39,44H,18-25,27H2,1H3,(H,40,45)(H,41,47) |
| InChIKey | LGIPKDGZISPJKD-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.79 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|