C51H52N6O7 — CID 69060443
(N-[1-[2-[[3-[2-[(4-hydroxyphenyl)methylamino]ethylcarbamoyl]benzoyl]-methylamino]ethyl]piperidin-4-yl]oxycarbonyl-2-phenylanilino)-(2-phenylphenyl)carbamic acid (PubChem CID 69060443) has the molecular formula C51H52N6O7 and a molecular weight of 861.01 g/mol. Its IUPAC name is (N-[1-[2-[[3-[2-[(4-hydroxyphenyl)methylamino]ethylcarbamoyl]benzoyl]-methylamino]ethyl]piperidin-4-yl]oxycarbonyl-2-phenylanilino)-(2-phenylphenyl)carbamic acid.
| Compound Name | (N-[1-[2-[[3-[2-[(4-hydroxyphenyl)methylamino]ethylcarbamoyl]benzoyl]-methylamino]ethyl]piperidin-4-yl]oxycarbonyl-2-phenylanilino)-(2-phenylphenyl)carbamic acid |
|---|---|
| PubChem CID | 69060443 |
| Molecular Formula | C51H52N6O7 |
| Molecular Weight | 861.01 g/mol |
| Exact Mass | 860.39 |
| IUPAC Name | (N-[1-[2-[[3-[2-[(4-hydroxyphenyl)methylamino]ethylcarbamoyl]benzoyl]-methylamino]ethyl]piperidin-4-yl]oxycarbonyl-2-phenylanilino)-(2-phenylphenyl)carbamic acid |
| SMILES | CN(CCN1CCC(OC(=O)N(c2ccccc2-c2ccccc2)N(C(=O)O)c2ccccc2-c2ccccc2)CC1)C(=O)c1cccc(C(=O)NCCNCc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C51H52N6O7/c1-54(49(60)41-18-12-17-40(35-41)48(59)53-30-29-52-36-37-23-25-42(58)26-24-37)33-34-55-31-27-43(28-32-55)64-51(63)57(47-22-11-9-20-45(47)39-15-6-3-7-16-39)56(50(61)62)46-21-10-8-19-44(46)38-13-4-2-5-14-38/h2-26,35,43,52,58H,27-34,36H2,1H3,(H,53,59)(H,61,62) |
| InChIKey | NBBHRAUUYHRQOD-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 154.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.01 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|