C50H51N5O6 — CID 69062317
[1-[2-[[3-[ethyl-[(4-hydroxy-2-methoxyphenyl)methylamino]carbamoyl]benzoyl]amino]ethyl]piperidin-4-yl] N,N-bis(2-phenylphenyl)carbamate (PubChem CID 69062317) has the molecular formula C50H51N5O6 and a molecular weight of 817.99 g/mol. Its IUPAC name is [1-[2-[[3-[ethyl-[(4-hydroxy-2-methoxyphenyl)methylamino]carbamoyl]benzoyl]amino]ethyl]piperidin-4-yl] N,N-bis(2-phenylphenyl)carbamate.
| Compound Name | [1-[2-[[3-[ethyl-[(4-hydroxy-2-methoxyphenyl)methylamino]carbamoyl]benzoyl]amino]ethyl]piperidin-4-yl] N,N-bis(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 69062317 |
| Molecular Formula | C50H51N5O6 |
| Molecular Weight | 817.99 g/mol |
| Exact Mass | 817.38 |
| IUPAC Name | [1-[2-[[3-[ethyl-[(4-hydroxy-2-methoxyphenyl)methylamino]carbamoyl]benzoyl]amino]ethyl]piperidin-4-yl] N,N-bis(2-phenylphenyl)carbamate |
| SMILES | CCN(NCc1ccc(O)cc1OC)C(=O)c1cccc(C(=O)NCCN2CCC(OC(=O)N(c3ccccc3-c3ccccc3)c3ccccc3-c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C50H51N5O6/c1-3-54(52-35-40-25-26-41(56)34-47(40)60-2)49(58)39-20-14-19-38(33-39)48(57)51-29-32-53-30-27-42(28-31-53)61-50(59)55(45-23-12-10-21-43(45)36-15-6-4-7-16-36)46-24-13-11-22-44(46)37-17-8-5-9-18-37/h4-26,33-34,42,52,56H,3,27-32,35H2,1-2H3,(H,51,57) |
| InChIKey | CRCXYLRLEAONLV-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.99 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|