C38H43N5O6 — CID 68587246
[1-[2-[[2-[3-[[(3,4-dihydroxyphenyl)methylamino]-ethylcarbamoyl]phenyl]-2-oxoethyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 68587246) has the molecular formula C38H43N5O6 and a molecular weight of 665.79 g/mol. Its IUPAC name is [1-[2-[[2-[3-[[(3,4-dihydroxyphenyl)methylamino]-ethylcarbamoyl]phenyl]-2-oxoethyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[2-[[2-[3-[[(3,4-dihydroxyphenyl)methylamino]-ethylcarbamoyl]phenyl]-2-oxoethyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 68587246 |
| Molecular Formula | C38H43N5O6 |
| Molecular Weight | 665.79 g/mol |
| Exact Mass | 665.32 |
| IUPAC Name | [1-[2-[[2-[3-[[(3,4-dihydroxyphenyl)methylamino]-ethylcarbamoyl]phenyl]-2-oxoethyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | CCN(NCc1ccc(O)c(O)c1)C(=O)c1cccc(C(=O)CNCCN2CCC(OC(=O)Nc3ccccc3-c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C38H43N5O6/c1-2-43(40-25-27-15-16-34(44)35(45)23-27)37(47)30-12-8-11-29(24-30)36(46)26-39-19-22-42-20-17-31(18-21-42)49-38(48)41-33-14-7-6-13-32(33)28-9-4-3-5-10-28/h3-16,23-24,31,39-40,44-45H,2,17-22,25-26H2,1H3,(H,41,48) |
| InChIKey | PDLRYSGTQLFGQV-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 143.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.79 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|