C29H32N4O4 — CID 87210667
[1-[2-[(3-formylphenyl)methylcarbamoylamino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 87210667) has the molecular formula C29H32N4O4 and a molecular weight of 500.60 g/mol. Its IUPAC name is [1-[2-[(3-formylphenyl)methylcarbamoylamino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[2-[(3-formylphenyl)methylcarbamoylamino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 87210667 |
| Molecular Formula | C29H32N4O4 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | [1-[2-[(3-formylphenyl)methylcarbamoylamino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | O=Cc1cccc(CNC(=O)NCCN2CCC(OC(=O)Nc3ccccc3-c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C29H32N4O4/c34-21-23-8-6-7-22(19-23)20-31-28(35)30-15-18-33-16-13-25(14-17-33)37-29(36)32-27-12-5-4-11-26(27)24-9-2-1-3-10-24/h1-12,19,21,25H,13-18,20H2,(H,32,36)(H2,30,31,35) |
| InChIKey | GBEKENPQEWJCKC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|