C28H34N4O5 — CID 66755742
[1-[2-[[5-[(2-hydroxyethylamino)methyl]furan-2-carbonyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 66755742) has the molecular formula C28H34N4O5 and a molecular weight of 506.60 g/mol. Its IUPAC name is [1-[2-[[5-[(2-hydroxyethylamino)methyl]furan-2-carbonyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[2-[[5-[(2-hydroxyethylamino)methyl]furan-2-carbonyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 66755742 |
| Molecular Formula | C28H34N4O5 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | [1-[2-[[5-[(2-hydroxyethylamino)methyl]furan-2-carbonyl]amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)OC1CCN(CCNC(=O)c2ccc(CNCCO)o2)CC1 |
| InChI | InChI=1S/C28H34N4O5/c33-19-15-29-20-23-10-11-26(36-23)27(34)30-14-18-32-16-12-22(13-17-32)37-28(35)31-25-9-5-4-8-24(25)21-6-2-1-3-7-21/h1-11,22,29,33H,12-20H2,(H,30,34)(H,31,35) |
| InChIKey | BGGKCJOKCTYHRM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|