C30H31N3O4 — CID 129296060
[1-[2-(6-formyl-1-oxo-3,4-dihydroisoquinolin-2-yl)ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 129296060) has the molecular formula C30H31N3O4 and a molecular weight of 497.60 g/mol. Its IUPAC name is [1-[2-(6-formyl-1-oxo-3,4-dihydroisoquinolin-2-yl)ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[2-(6-formyl-1-oxo-3,4-dihydroisoquinolin-2-yl)ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 129296060 |
| Molecular Formula | C30H31N3O4 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | [1-[2-(6-formyl-1-oxo-3,4-dihydroisoquinolin-2-yl)ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | O=Cc1ccc2c(c1)CCN(CCN1CCC(OC(=O)Nc3ccccc3-c3ccccc3)CC1)C2=O |
| InChI | InChI=1S/C30H31N3O4/c34-21-22-10-11-27-24(20-22)12-17-33(29(27)35)19-18-32-15-13-25(14-16-32)37-30(36)31-28-9-5-4-8-26(28)23-6-2-1-3-7-23/h1-11,20-21,25H,12-19H2,(H,31,36) |
| InChIKey | HEAOAFSLXVKJCT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|