C45H47N5O4 — CID 69061603
[1-[2-[[2-[3-[[2-(cyclopropylamino)acetyl]amino]phenyl]-2-oxoethyl]amino]ethyl]piperidin-4-yl] N,N-bis(2-phenylphenyl)carbamate (PubChem CID 69061603) has the molecular formula C45H47N5O4 and a molecular weight of 721.90 g/mol. Its IUPAC name is [1-[2-[[2-[3-[[2-(cyclopropylamino)acetyl]amino]phenyl]-2-oxoethyl]amino]ethyl]piperidin-4-yl] N,N-bis(2-phenylphenyl)carbamate.
| Compound Name | [1-[2-[[2-[3-[[2-(cyclopropylamino)acetyl]amino]phenyl]-2-oxoethyl]amino]ethyl]piperidin-4-yl] N,N-bis(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 69061603 |
| Molecular Formula | C45H47N5O4 |
| Molecular Weight | 721.90 g/mol |
| Exact Mass | 721.36 |
| IUPAC Name | [1-[2-[[2-[3-[[2-(cyclopropylamino)acetyl]amino]phenyl]-2-oxoethyl]amino]ethyl]piperidin-4-yl] N,N-bis(2-phenylphenyl)carbamate |
| SMILES | O=C(CNC1CC1)Nc1cccc(C(=O)CNCCN2CCC(OC(=O)N(c3ccccc3-c3ccccc3)c3ccccc3-c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C45H47N5O4/c51-43(35-16-11-17-37(30-35)48-44(52)32-47-36-22-23-36)31-46-26-29-49-27-24-38(25-28-49)54-45(53)50(41-20-9-7-18-39(41)33-12-3-1-4-13-33)42-21-10-8-19-40(42)34-14-5-2-6-15-34/h1-21,30,36,38,46-47H,22-29,31-32H2,(H,48,52) |
| InChIKey | YVMBRFRGRKHUGW-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.90 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|