C11H18ClFN2O2S — CID 119964790
1-(3-fluorophenyl)-N-[3-(methylamino)propyl]methanesulfonamide;hydrochloride (PubChem CID 119964790) has the molecular formula C11H18ClFN2O2S and a molecular weight of 296.80 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-[3-(methylamino)propyl]methanesulfonamide;hydrochloride.
| Compound Name | 1-(3-fluorophenyl)-N-[3-(methylamino)propyl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119964790 |
| Molecular Formula | C11H18ClFN2O2S |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 1-(3-fluorophenyl)-N-[3-(methylamino)propyl]methanesulfonamide;hydrochloride |
| SMILES | CNCCCNS(=O)(=O)Cc1cccc(F)c1.Cl |
| InChI | InChI=1S/C11H17FN2O2S.ClH/c1-13-6-3-7-14-17(15,16)9-10-4-2-5-11(12)8-10;/h2,4-5,8,13-14H,3,6-7,9H2,1H3;1H |
| InChIKey | GZCCIXNNNUMKQJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|