C10H24ClN3O2S — CID 119965247
2-(1-aminoethyl)-N-ethyl-N-methylpiperidine-1-sulfonamide;hydrochloride (PubChem CID 119965247) has the molecular formula C10H24ClN3O2S and a molecular weight of 285.84 g/mol. Its IUPAC name is 2-(1-aminoethyl)-N-ethyl-N-methylpiperidine-1-sulfonamide;hydrochloride.
| Compound Name | 2-(1-aminoethyl)-N-ethyl-N-methylpiperidine-1-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119965247 |
| Molecular Formula | C10H24ClN3O2S |
| Molecular Weight | 285.84 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 2-(1-aminoethyl)-N-ethyl-N-methylpiperidine-1-sulfonamide;hydrochloride |
| SMILES | CCN(C)S(=O)(=O)N1CCCCC1C(C)N.Cl |
| InChI | InChI=1S/C10H23N3O2S.ClH/c1-4-12(3)16(14,15)13-8-6-5-7-10(13)9(2)11;/h9-10H,4-8,11H2,1-3H3;1H |
| InChIKey | BTFOXLDTOCHZDN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.84 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |