C15H25ClN2O2S — CID 119970304
2-phenyl-N-(1-piperidin-3-ylethyl)ethanesulfonamide;hydrochloride (PubChem CID 119970304) has the molecular formula C15H25ClN2O2S and a molecular weight of 332.90 g/mol. Its IUPAC name is 2-phenyl-N-(1-piperidin-3-ylethyl)ethanesulfonamide;hydrochloride.
| Compound Name | 2-phenyl-N-(1-piperidin-3-ylethyl)ethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119970304 |
| Molecular Formula | C15H25ClN2O2S |
| Molecular Weight | 332.90 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-phenyl-N-(1-piperidin-3-ylethyl)ethanesulfonamide;hydrochloride |
| SMILES | CC(NS(=O)(=O)CCc1ccccc1)C1CCCNC1.Cl |
| InChI | InChI=1S/C15H24N2O2S.ClH/c1-13(15-8-5-10-16-12-15)17-20(18,19)11-9-14-6-3-2-4-7-14;/h2-4,6-7,13,15-17H,5,8-12H2,1H3;1H |
| InChIKey | CJHIJNVBLFKJOC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.90 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |