C13H21N3O2S — CID 62046742
2-(1-piperidin-3-ylethylamino)benzenesulfonamide (PubChem CID 62046742) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 2-(1-piperidin-3-ylethylamino)benzenesulfonamide.
| Compound Name | 2-(1-piperidin-3-ylethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 62046742 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-(1-piperidin-3-ylethylamino)benzenesulfonamide |
| SMILES | CC(Nc1ccccc1S(N)(=O)=O)C1CCCNC1 |
| InChI | InChI=1S/C13H21N3O2S/c1-10(11-5-4-8-15-9-11)16-12-6-2-3-7-13(12)19(14,17)18/h2-3,6-7,10-11,15-16H,4-5,8-9H2,1H3,(H2,14,17,18) |
| InChIKey | MBVAOJGJLFDHBO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |