C13H21N3 — CID 22184580
2-N-(1-piperidin-3-ylethyl)benzene-1,2-diamine (PubChem CID 22184580) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-N-(1-piperidin-3-ylethyl)benzene-1,2-diamine.
| Compound Name | 2-N-(1-piperidin-3-ylethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 22184580 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 2-N-(1-piperidin-3-ylethyl)benzene-1,2-diamine |
| SMILES | CC(Nc1ccccc1N)C1CCCNC1 |
| InChI | InChI=1S/C13H21N3/c1-10(11-5-4-8-15-9-11)16-13-7-3-2-6-12(13)14/h2-3,6-7,10-11,15-16H,4-5,8-9,14H2,1H3 |
| InChIKey | FPFCHZGSSCWOGD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|