C12H19N5O — CID 62685001
3-(1-piperidin-3-ylethylamino)pyrazine-2-carboxamide (PubChem CID 62685001) has the molecular formula C12H19N5O and a molecular weight of 249.32 g/mol. Its IUPAC name is 3-(1-piperidin-3-ylethylamino)pyrazine-2-carboxamide.
| Compound Name | 3-(1-piperidin-3-ylethylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 62685001 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 3-(1-piperidin-3-ylethylamino)pyrazine-2-carboxamide |
| SMILES | CC(Nc1nccnc1C(N)=O)C1CCCNC1 |
| InChI | InChI=1S/C12H19N5O/c1-8(9-3-2-4-14-7-9)17-12-10(11(13)18)15-5-6-16-12/h5-6,8-9,14H,2-4,7H2,1H3,(H2,13,18)(H,16,17) |
| InChIKey | CZARHHGEZHZYNT-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |