C14H21N3O4S — CID 119975090
1-[1-[(4-nitrophenyl)methylsulfonyl]piperidin-4-yl]ethanamine (PubChem CID 119975090) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is 1-[1-[(4-nitrophenyl)methylsulfonyl]piperidin-4-yl]ethanamine.
| Compound Name | 1-[1-[(4-nitrophenyl)methylsulfonyl]piperidin-4-yl]ethanamine |
|---|---|
| PubChem CID | 119975090 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1-[1-[(4-nitrophenyl)methylsulfonyl]piperidin-4-yl]ethanamine |
| SMILES | CC(N)C1CCN(S(=O)(=O)Cc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C14H21N3O4S/c1-11(15)13-6-8-16(9-7-13)22(20,21)10-12-2-4-14(5-3-12)17(18)19/h2-5,11,13H,6-10,15H2,1H3 |
| InChIKey | KYMXDVYIUKOKMT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|