C12H16ClN3O4S — CID 119977694
1-[1-(2-chloro-6-nitrophenyl)sulfonylpyrrolidin-3-yl]-N-methylmethanamine (PubChem CID 119977694) has the molecular formula C12H16ClN3O4S and a molecular weight of 333.80 g/mol. Its IUPAC name is 1-[1-(2-chloro-6-nitrophenyl)sulfonylpyrrolidin-3-yl]-N-methylmethanamine.
| Compound Name | 1-[1-(2-chloro-6-nitrophenyl)sulfonylpyrrolidin-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 119977694 |
| Molecular Formula | C12H16ClN3O4S |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 1-[1-(2-chloro-6-nitrophenyl)sulfonylpyrrolidin-3-yl]-N-methylmethanamine |
| SMILES | CNCC1CCN(S(=O)(=O)c2c(Cl)cccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H16ClN3O4S/c1-14-7-9-5-6-15(8-9)21(19,20)12-10(13)3-2-4-11(12)16(17)18/h2-4,9,14H,5-8H2,1H3 |
| InChIKey | CWMFQNPVOTWXIZ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|