C13H18ClFN2O2S — CID 120709783
1-[1-(2-chloro-6-fluorophenyl)sulfonylpiperidin-4-yl]-N-methylmethanamine (PubChem CID 120709783) has the molecular formula C13H18ClFN2O2S and a molecular weight of 320.82 g/mol. Its IUPAC name is 1-[1-(2-chloro-6-fluorophenyl)sulfonylpiperidin-4-yl]-N-methylmethanamine.
| Compound Name | 1-[1-(2-chloro-6-fluorophenyl)sulfonylpiperidin-4-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 120709783 |
| Molecular Formula | C13H18ClFN2O2S |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 1-[1-(2-chloro-6-fluorophenyl)sulfonylpiperidin-4-yl]-N-methylmethanamine |
| SMILES | CNCC1CCN(S(=O)(=O)c2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C13H18ClFN2O2S/c1-16-9-10-5-7-17(8-6-10)20(18,19)13-11(14)3-2-4-12(13)15/h2-4,10,16H,5-9H2,1H3 |
| InChIKey | NYNPFNHYGKTXLX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |