C12H18ClN3O4S — CID 119978596
N,2-dimethyl-5-nitro-N-pyrrolidin-3-ylbenzenesulfonamide;hydrochloride (PubChem CID 119978596) has the molecular formula C12H18ClN3O4S and a molecular weight of 335.81 g/mol. Its IUPAC name is N,2-dimethyl-5-nitro-N-pyrrolidin-3-ylbenzenesulfonamide;hydrochloride.
| Compound Name | N,2-dimethyl-5-nitro-N-pyrrolidin-3-ylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119978596 |
| Molecular Formula | C12H18ClN3O4S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | N,2-dimethyl-5-nitro-N-pyrrolidin-3-ylbenzenesulfonamide;hydrochloride |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)N(C)C1CCNC1.Cl |
| InChI | InChI=1S/C12H17N3O4S.ClH/c1-9-3-4-10(15(16)17)7-12(9)20(18,19)14(2)11-5-6-13-8-11;/h3-4,7,11,13H,5-6,8H2,1-2H3;1H |
| InChIKey | LFOLNEDHRNFRRD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|