C14H22ClN3O4S — CID 119976314
2-methyl-5-nitro-N-propyl-N-pyrrolidin-3-ylbenzenesulfonamide;hydrochloride (PubChem CID 119976314) has the molecular formula C14H22ClN3O4S and a molecular weight of 363.87 g/mol. Its IUPAC name is 2-methyl-5-nitro-N-propyl-N-pyrrolidin-3-ylbenzenesulfonamide;hydrochloride.
| Compound Name | 2-methyl-5-nitro-N-propyl-N-pyrrolidin-3-ylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119976314 |
| Molecular Formula | C14H22ClN3O4S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 2-methyl-5-nitro-N-propyl-N-pyrrolidin-3-ylbenzenesulfonamide;hydrochloride |
| SMILES | CCCN(C1CCNC1)S(=O)(=O)c1cc([N+](=O)[O-])ccc1C.Cl |
| InChI | InChI=1S/C14H21N3O4S.ClH/c1-3-8-16(13-6-7-15-10-13)22(20,21)14-9-12(17(18)19)5-4-11(14)2;/h4-5,9,13,15H,3,6-8,10H2,1-2H3;1H |
| InChIKey | SEZXBGIGIABAQV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|