C14H20FN3O4S — CID 120709369
3-fluoro-4-methyl-5-nitro-N-propyl-N-pyrrolidin-3-ylbenzenesulfonamide (PubChem CID 120709369) has the molecular formula C14H20FN3O4S and a molecular weight of 345.40 g/mol. Its IUPAC name is 3-fluoro-4-methyl-5-nitro-N-propyl-N-pyrrolidin-3-ylbenzenesulfonamide.
| Compound Name | 3-fluoro-4-methyl-5-nitro-N-propyl-N-pyrrolidin-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 120709369 |
| Molecular Formula | C14H20FN3O4S |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 3-fluoro-4-methyl-5-nitro-N-propyl-N-pyrrolidin-3-ylbenzenesulfonamide |
| SMILES | CCCN(C1CCNC1)S(=O)(=O)c1cc(F)c(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H20FN3O4S/c1-3-6-17(11-4-5-16-9-11)23(21,22)12-7-13(15)10(2)14(8-12)18(19)20/h7-8,11,16H,3-6,9H2,1-2H3 |
| InChIKey | OZAHZNOSYFWDLN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|