C15H18Cl2N2O2S — CID 119978801
4-chloro-N-methyl-N-pyrrolidin-3-ylnaphthalene-1-sulfonamide;hydrochloride (PubChem CID 119978801) has the molecular formula C15H18Cl2N2O2S and a molecular weight of 361.29 g/mol. Its IUPAC name is 4-chloro-N-methyl-N-pyrrolidin-3-ylnaphthalene-1-sulfonamide;hydrochloride.
| Compound Name | 4-chloro-N-methyl-N-pyrrolidin-3-ylnaphthalene-1-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119978801 |
| Molecular Formula | C15H18Cl2N2O2S |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 4-chloro-N-methyl-N-pyrrolidin-3-ylnaphthalene-1-sulfonamide;hydrochloride |
| SMILES | CN(C1CCNC1)S(=O)(=O)c1ccc(Cl)c2ccccc12.Cl |
| InChI | InChI=1S/C15H17ClN2O2S.ClH/c1-18(11-8-9-17-10-11)21(19,20)15-7-6-14(16)12-4-2-3-5-13(12)15;/h2-7,11,17H,8-10H2,1H3;1H |
| InChIKey | LRBMPIRFUQGVDQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |