C9H14Cl2N2O2S2 — CID 119978813
5-chloro-N-methyl-N-pyrrolidin-3-ylthiophene-2-sulfonamide;hydrochloride (PubChem CID 119978813) has the molecular formula C9H14Cl2N2O2S2 and a molecular weight of 317.26 g/mol. Its IUPAC name is 5-chloro-N-methyl-N-pyrrolidin-3-ylthiophene-2-sulfonamide;hydrochloride.
| Compound Name | 5-chloro-N-methyl-N-pyrrolidin-3-ylthiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119978813 |
| Molecular Formula | C9H14Cl2N2O2S2 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | 5-chloro-N-methyl-N-pyrrolidin-3-ylthiophene-2-sulfonamide;hydrochloride |
| SMILES | CN(C1CCNC1)S(=O)(=O)c1ccc(Cl)s1.Cl |
| InChI | InChI=1S/C9H13ClN2O2S2.ClH/c1-12(7-4-5-11-6-7)16(13,14)9-3-2-8(10)15-9;/h2-3,7,11H,4-6H2,1H3;1H |
| InChIKey | KBTHXWYEIMDSOS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |