C11H15FN2O2S — CID 60807173
4-fluoro-N-methyl-N-pyrrolidin-3-ylbenzenesulfonamide (PubChem CID 60807173) has the molecular formula C11H15FN2O2S and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-fluoro-N-methyl-N-pyrrolidin-3-ylbenzenesulfonamide.
| Compound Name | 4-fluoro-N-methyl-N-pyrrolidin-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 60807173 |
| Molecular Formula | C11H15FN2O2S |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 4-fluoro-N-methyl-N-pyrrolidin-3-ylbenzenesulfonamide |
| SMILES | CN(C1CCNC1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H15FN2O2S/c1-14(10-6-7-13-8-10)17(15,16)11-4-2-9(12)3-5-11/h2-5,10,13H,6-8H2,1H3 |
| InChIKey | RVVXTYPZZWGVOF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |